C12H19NOS — CID 94684706
2-[2-(2,5-dimethylphenyl)sulfanylethoxy]ethanamine (PubChem CID 94684706) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)sulfanylethoxy]ethanamine.
| Compound Name | 2-[2-(2,5-dimethylphenyl)sulfanylethoxy]ethanamine |
|---|---|
| PubChem CID | 94684706 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)sulfanylethoxy]ethanamine |
| SMILES | Cc1ccc(C)c(SCCOCCN)c1 |
| InChI | InChI=1S/C12H19NOS/c1-10-3-4-11(2)12(9-10)15-8-7-14-6-5-13/h3-4,9H,5-8,13H2,1-2H3 |
| InChIKey | PWAGLMZFVYMTKI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|