C15H25NS — CID 65255604
5-(2,5-dimethylphenyl)sulfanyl-2,2-dimethylpentan-1-amine (PubChem CID 65255604) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)sulfanyl-2,2-dimethylpentan-1-amine.
| Compound Name | 5-(2,5-dimethylphenyl)sulfanyl-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65255604 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 5-(2,5-dimethylphenyl)sulfanyl-2,2-dimethylpentan-1-amine |
| SMILES | Cc1ccc(C)c(SCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C15H25NS/c1-12-6-7-13(2)14(10-12)17-9-5-8-15(3,4)11-16/h6-7,10H,5,8-9,11,16H2,1-4H3 |
| InChIKey | QVJDULKBDHAVJT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|