C15H25NOS — CID 64813625
1-amino-6-(2,5-dimethylphenyl)sulfanyl-2-methylhexan-2-ol (PubChem CID 64813625) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-amino-6-(2,5-dimethylphenyl)sulfanyl-2-methylhexan-2-ol.
| Compound Name | 1-amino-6-(2,5-dimethylphenyl)sulfanyl-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 64813625 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-amino-6-(2,5-dimethylphenyl)sulfanyl-2-methylhexan-2-ol |
| SMILES | Cc1ccc(C)c(SCCCCC(C)(O)CN)c1 |
| InChI | InChI=1S/C15H25NOS/c1-12-6-7-13(2)14(10-12)18-9-5-4-8-15(3,17)11-16/h6-7,10,17H,4-5,8-9,11,16H2,1-3H3 |
| InChIKey | XSYAVPHWVRAKQG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|