C10H15NS — CID 117032475
1-(2,5-dimethylphenyl)sulfanylethanamine (PubChem CID 117032475) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfanylethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 117032475 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfanylethanamine |
| SMILES | Cc1ccc(C)c(SC(C)N)c1 |
| InChI | InChI=1S/C10H15NS/c1-7-4-5-8(2)10(6-7)12-9(3)11/h4-6,9H,11H2,1-3H3 |
| InChIKey | BFNDXTHLLYDLCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|