C9H13NS — CID 117033774
N-(2,5-dimethylphenyl)sulfanylmethanamine (PubChem CID 117033774) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)sulfanylmethanamine.
| Compound Name | N-(2,5-dimethylphenyl)sulfanylmethanamine |
|---|---|
| PubChem CID | 117033774 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-(2,5-dimethylphenyl)sulfanylmethanamine |
| SMILES | CNSc1cc(C)ccc1C |
| InChI | InChI=1S/C9H13NS/c1-7-4-5-8(2)9(6-7)11-10-3/h4-6,10H,1-3H3 |
| InChIKey | UIWBZXXSAUOILQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|