C10H11NS — CID 3277206
2-(2,5-dimethylphenyl)sulfanylacetonitrile (PubChem CID 3277206) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanylacetonitrile.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanylacetonitrile |
|---|---|
| PubChem CID | 3277206 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanylacetonitrile |
| SMILES | Cc1ccc(C)c(SCC#N)c1 |
| InChI | InChI=1S/C10H11NS/c1-8-3-4-9(2)10(7-8)12-6-5-11/h3-4,7H,6H2,1-2H3 |
| InChIKey | JFYIMXQRDDHBFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |