C8H10BrN — CID 154170384
N-bromo-2,5-dimethylaniline (PubChem CID 154170384) has the molecular formula C8H10BrN and a molecular weight of 200.08 g/mol. Its IUPAC name is N-bromo-2,5-dimethylaniline.
| Compound Name | N-bromo-2,5-dimethylaniline |
|---|---|
| PubChem CID | 154170384 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | N-bromo-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(NBr)c1 |
| InChI | InChI=1S/C8H10BrN/c1-6-3-4-7(2)8(5-6)10-9/h3-5,10H,1-2H3 |
| InChIKey | WMPJIWFGPJBOTQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|