C14H16N2S — CID 80893702
6-(2,5-dimethylphenyl)sulfanyl-N-methylpyridin-2-amine (PubChem CID 80893702) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)sulfanyl-N-methylpyridin-2-amine.
| Compound Name | 6-(2,5-dimethylphenyl)sulfanyl-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 80893702 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 6-(2,5-dimethylphenyl)sulfanyl-N-methylpyridin-2-amine |
| SMILES | CNc1cccc(Sc2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C14H16N2S/c1-10-7-8-11(2)12(9-10)17-14-6-4-5-13(15-3)16-14/h4-9H,1-3H3,(H,15,16) |
| InChIKey | PTJIJJDDVHNEKM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |