C16H20N2S — CID 80893381
6-(2,5-dimethylphenyl)sulfanyl-N-propylpyridin-2-amine (PubChem CID 80893381) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)sulfanyl-N-propylpyridin-2-amine.
| Compound Name | 6-(2,5-dimethylphenyl)sulfanyl-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 80893381 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-(2,5-dimethylphenyl)sulfanyl-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(Sc2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C16H20N2S/c1-4-10-17-15-6-5-7-16(18-15)19-14-11-12(2)8-9-13(14)3/h5-9,11H,4,10H2,1-3H3,(H,17,18) |
| InChIKey | HQARDUFEOSPXSM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |