C14H14O2S — CID 104651891
1-[5-(2,5-dimethylphenyl)sulfanylfuran-2-yl]ethanone (PubChem CID 104651891) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylphenyl)sulfanylfuran-2-yl]ethanone.
| Compound Name | 1-[5-(2,5-dimethylphenyl)sulfanylfuran-2-yl]ethanone |
|---|---|
| PubChem CID | 104651891 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-[5-(2,5-dimethylphenyl)sulfanylfuran-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2cc(C)ccc2C)o1 |
| InChI | InChI=1S/C14H14O2S/c1-9-4-5-10(2)13(8-9)17-14-7-6-12(16-14)11(3)15/h4-8H,1-3H3 |
| InChIKey | IFEULSHCWBXGFE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |