C13H20N2 — CID 63178280
N'-(2,5-dimethylphenyl)-2,2-dimethylpropanimidamide (PubChem CID 63178280) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-2,2-dimethylpropanimidamide.
| Compound Name | N'-(2,5-dimethylphenyl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 63178280 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-2,2-dimethylpropanimidamide |
| SMILES | Cc1ccc(C)c(/N=C(\N)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H20N2/c1-9-6-7-10(2)11(8-9)15-12(14)13(3,4)5/h6-8H,1-5H3,(H2,14,15) |
| InChIKey | SYLJSPTWGCFNGP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|