About N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine
N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine (PubChem CID 142125377) has the molecular formula C21H25N5O
and a molecular weight of 363.47 g/mol. Its IUPAC name is N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine.
Molecular Properties
| Compound Name | N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine |
| PubChem CID | 142125377 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine |
| SMILES | CNN.N/C(=N\c1ccccc1Cc1ccccc1N)c1ccccc1O |
| InChI | InChI=1S/C20H19N3O.CH6N2/c21-17-10-4-1-7-14(17)13-15-8-2-5-11-18(15)23-20(22)16-9-3-6-12-19(16)24;1-3-2/h1-12,24H,13,21H2,(H2,22,23);3H,2H2,1H3 |
| InChIKey | GDAMTNZYIAEBKE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine?
The IUPAC name of N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine (CID 142125377) is N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine.
What is the SMILES notation for N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine?
The canonical SMILES for N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine is CNN.N/C(=N\c1ccccc1Cc1ccccc1N)c1ccccc1O.
What is the InChIKey of N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine?
The InChIKey is GDAMTNZYIAEBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O.CH6N2/c21-17-10-4-1-7-14(17)13-15-8-2-5-11-18(15)23-20(22)16-9-3-6-12-19(16)24;1-3-2/h1-12,24H,13,21H2,(H2,22,23);3H,2H2,1H3.
What are the key properties of N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine?
N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine has a molecular weight of 363.47 g/mol, XLogP of 2.68, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[(2-aminophenyl)methyl]phenyl]-2-hydroxybenzenecarboximidamide;methylhydrazine is sourced from PubChem (CID 142125377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).