C16H24N2S — CID 8775712
cyclohexylmethyl N'-[(1S)-1-phenylethyl]carbamimidothioate (PubChem CID 8775712) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is cyclohexylmethyl N'-[(1S)-1-phenylethyl]carbamimidothioate.
| Compound Name | cyclohexylmethyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775712 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | cyclohexylmethyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
| SMILES | C[C@H](/N=C(\N)SCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H24N2S/c1-13(15-10-6-3-7-11-15)18-16(17)19-12-14-8-4-2-5-9-14/h3,6-7,10-11,13-14H,2,4-5,8-9,12H2,1H3,(H2,17,18)/t13-/m0/s1 |
| InChIKey | NGFPRJDSMRHUBQ-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|