C17H28Si — CID 123237972
2-cyclohexylethyl(2-phenylpropyl)silane (PubChem CID 123237972) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is 2-cyclohexylethyl(2-phenylpropyl)silane.
| Compound Name | 2-cyclohexylethyl(2-phenylpropyl)silane |
|---|---|
| PubChem CID | 123237972 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-cyclohexylethyl(2-phenylpropyl)silane |
| SMILES | CC(C[SiH2]CCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H28Si/c1-15(17-10-6-3-7-11-17)14-18-13-12-16-8-4-2-5-9-16/h3,6-7,10-11,15-16H,2,4-5,8-9,12-14,18H2,1H3 |
| InChIKey | VIYRPMHYMNETSQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|