C13H19ClN2OS2 — CID 8775864
2-(4-chlorophenyl)sulfanylethyl N'-[(2R)-1-methoxypropan-2-yl]carbamimidothioate (PubChem CID 8775864) has the molecular formula C13H19ClN2OS2 and a molecular weight of 318.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanylethyl N'-[(2R)-1-methoxypropan-2-yl]carbamimidothioate.
| Compound Name | 2-(4-chlorophenyl)sulfanylethyl N'-[(2R)-1-methoxypropan-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 8775864 |
| Molecular Formula | C13H19ClN2OS2 |
| Molecular Weight | 318.90 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanylethyl N'-[(2R)-1-methoxypropan-2-yl]carbamimidothioate |
| SMILES | COC[C@@H](C)/N=C(\N)SCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2OS2/c1-10(9-17-2)16-13(15)19-8-7-18-12-5-3-11(14)4-6-12/h3-6,10H,7-9H2,1-2H3,(H2,15,16)/t10-/m1/s1 |
| InChIKey | IJRPPBVCZLTEJP-SNVBAGLBSA-N |
| XLogP | 3.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|