C12H16ClNO3S — CID 79676327
2-(4-chlorophenyl)sulfanyl-N-(2-methoxyethoxy)propanamide (PubChem CID 79676327) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(2-methoxyethoxy)propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 79676327 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(2-methoxyethoxy)propanamide |
| SMILES | COCCONC(=O)C(C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-9(12(15)14-17-8-7-16-2)18-11-5-3-10(13)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | APICHAYTHVCTBA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|