C12H16ClNO4 — CID 164935442
(2S)-2-(4-chlorophenoxy)-N-(2-methoxyethoxy)propanamide (PubChem CID 164935442) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-(2-methoxyethoxy)propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 164935442 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-(2-methoxyethoxy)propanamide |
| SMILES | COCCONC(=O)[C@H](C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO4/c1-9(12(15)14-17-8-7-16-2)18-11-5-3-10(13)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | XLVKDJRNAUNULS-VIFPVBQESA-N |
| XLogP | 1.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|