C8H7Cl3N2 — CID 91379926
1-chloroethyl-(2,4-dichlorophenyl)diazene (PubChem CID 91379926) has the molecular formula C8H7Cl3N2 and a molecular weight of 237.52 g/mol. Its IUPAC name is 1-chloroethyl-(2,4-dichlorophenyl)diazene.
| Compound Name | 1-chloroethyl-(2,4-dichlorophenyl)diazene |
|---|---|
| PubChem CID | 91379926 |
| Molecular Formula | C8H7Cl3N2 |
| Molecular Weight | 237.52 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 1-chloroethyl-(2,4-dichlorophenyl)diazene |
| SMILES | CC(Cl)/N=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl3N2/c1-5(9)12-13-8-3-2-6(10)4-7(8)11/h2-5H,1H3/b13-12+ |
| InChIKey | DBWXTQMLFVIRDR-OUKQBFOZSA-N |
| XLogP | 4.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|