C14H10Cl4N2O — CID 170920225
4-chloro-2-[1-[(2,4,6-trichlorophenyl)diazenyl]ethyl]phenol (PubChem CID 170920225) has the molecular formula C14H10Cl4N2O and a molecular weight of 364.06 g/mol. Its IUPAC name is 4-chloro-2-[1-[(2,4,6-trichlorophenyl)diazenyl]ethyl]phenol.
| Compound Name | 4-chloro-2-[1-[(2,4,6-trichlorophenyl)diazenyl]ethyl]phenol |
|---|---|
| PubChem CID | 170920225 |
| Molecular Formula | C14H10Cl4N2O |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 4-chloro-2-[1-[(2,4,6-trichlorophenyl)diazenyl]ethyl]phenol |
| SMILES | CC(/N=N/c1c(Cl)cc(Cl)cc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H10Cl4N2O/c1-7(10-4-8(15)2-3-13(10)21)19-20-14-11(17)5-9(16)6-12(14)18/h2-7,21H,1H3/b20-19+ |
| InChIKey | DUHVSJOYERZDCU-FMQUCBEESA-N |
| XLogP | 6.85 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|