C12H7Cl2N2NaO3S — CID 23702673
sodium 4-[(2,4-dichlorophenyl)diazenyl]benzenesulfonate (PubChem CID 23702673) has the molecular formula C12H7Cl2N2NaO3S and a molecular weight of 353.16 g/mol. Its IUPAC name is sodium 4-[(2,4-dichlorophenyl)diazenyl]benzenesulfonate.
| Compound Name | sodium 4-[(2,4-dichlorophenyl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 23702673 |
| Molecular Formula | C12H7Cl2N2NaO3S |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | sodium 4-[(2,4-dichlorophenyl)diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(Cl)cc2Cl)cc1.[Na+] |
| InChI | InChI=1S/C12H8Cl2N2O3S.Na/c13-8-1-6-12(11(14)7-8)16-15-9-2-4-10(5-3-9)20(17,18)19;/h1-7H,(H,17,18,19);/q;+1/p-1/b16-15+; |
| InChIKey | WYJCSLHSKLHTQE-GEEYTBSJSA-M |
| XLogP | 1.32 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|