C17H13Cl3N2O2S — CID 173492705
4-amino-6-(5-chlorothiophen-2-yl)-6-(2,4-dichlorophenyl)imino-5-methyl-3-oxohex-4-enal (PubChem CID 173492705) has the molecular formula C17H13Cl3N2O2S and a molecular weight of 415.73 g/mol. Its IUPAC name is 4-amino-6-(5-chlorothiophen-2-yl)-6-(2,4-dichlorophenyl)imino-5-methyl-3-oxohex-4-enal.
| Compound Name | 4-amino-6-(5-chlorothiophen-2-yl)-6-(2,4-dichlorophenyl)imino-5-methyl-3-oxohex-4-enal |
|---|---|
| PubChem CID | 173492705 |
| Molecular Formula | C17H13Cl3N2O2S |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 4-amino-6-(5-chlorothiophen-2-yl)-6-(2,4-dichlorophenyl)imino-5-methyl-3-oxohex-4-enal |
| SMILES | CC(=C(N)C(=O)CC=O)/C(=N\c1ccc(Cl)cc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H13Cl3N2O2S/c1-9(16(21)13(24)6-7-23)17(14-4-5-15(20)25-14)22-12-3-2-10(18)8-11(12)19/h2-5,7-8H,6,21H2,1H3/b16-9?,22-17+ |
| InChIKey | PZVUJXRKBOVUBQ-XIZFSGJZSA-N |
| XLogP | 5.22 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|