C16H27N3 — CID 169215702
ethane;(Z)-6-methyl-4-phenyliminohept-2-ene-1,2-diamine (PubChem CID 169215702) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;(Z)-6-methyl-4-phenyliminohept-2-ene-1,2-diamine.
| Compound Name | ethane;(Z)-6-methyl-4-phenyliminohept-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 169215702 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | ethane;(Z)-6-methyl-4-phenyliminohept-2-ene-1,2-diamine |
| SMILES | CC.CC(C)CC(/C=C(\N)CN)=N\c1ccccc1 |
| InChI | InChI=1S/C14H21N3.C2H6/c1-11(2)8-14(9-12(16)10-15)17-13-6-4-3-5-7-13;1-2/h3-7,9,11H,8,10,15-16H2,1-2H3;1-2H3/b12-9-,17-14+; |
| InChIKey | AQXHMYMSOMRMBS-PLZCLYOESA-N |
| XLogP | 3.63 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|