C21H24N2O2 — CID 177190557
4-[[(Z)-3-amino-6-methyl-1-phenylhept-2-enylidene]amino]benzoic acid (PubChem CID 177190557) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[[(Z)-3-amino-6-methyl-1-phenylhept-2-enylidene]amino]benzoic acid.
| Compound Name | 4-[[(Z)-3-amino-6-methyl-1-phenylhept-2-enylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 177190557 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[[(Z)-3-amino-6-methyl-1-phenylhept-2-enylidene]amino]benzoic acid |
| SMILES | CC(C)CC/C(N)=C/C(=N\c1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(2)8-11-18(22)14-20(16-6-4-3-5-7-16)23-19-12-9-17(10-13-19)21(24)25/h3-7,9-10,12-15H,8,11,22H2,1-2H3,(H,24,25)/b18-14-,23-20+ |
| InChIKey | KOCPIRXTQBIPPV-UFBXYIFPSA-N |
| XLogP | 4.78 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|