C19H23NO4 — CID 122577799
propan-2-yl 3,4,5-trimethoxy-N-phenylbenzenecarboximidate (PubChem CID 122577799) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is propan-2-yl 3,4,5-trimethoxy-N-phenylbenzenecarboximidate.
| Compound Name | propan-2-yl 3,4,5-trimethoxy-N-phenylbenzenecarboximidate |
|---|---|
| PubChem CID | 122577799 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | propan-2-yl 3,4,5-trimethoxy-N-phenylbenzenecarboximidate |
| SMILES | COc1cc(/C(=N/c2ccccc2)OC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO4/c1-13(2)24-19(20-15-9-7-6-8-10-15)14-11-16(21-3)18(23-5)17(12-14)22-4/h6-13H,1-5H3/b20-19- |
| InChIKey | USXOXWCHNJFJOE-VXPUYCOJSA-N |
| XLogP | 4.22 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|