C39H45N3O4 — CID 122577767
tripropan-2-yl 3-N-(2-methoxyphenyl)-1-N,5-N-bis(2-methylphenyl)benzene-1,3,5-tricarboximidate (PubChem CID 122577767) has the molecular formula C39H45N3O4 and a molecular weight of 619.81 g/mol. Its IUPAC name is tripropan-2-yl 3-N-(2-methoxyphenyl)-1-N,5-N-bis(2-methylphenyl)benzene-1,3,5-tricarboximidate.
| Compound Name | tripropan-2-yl 3-N-(2-methoxyphenyl)-1-N,5-N-bis(2-methylphenyl)benzene-1,3,5-tricarboximidate |
|---|---|
| PubChem CID | 122577767 |
| Molecular Formula | C39H45N3O4 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | tripropan-2-yl 3-N-(2-methoxyphenyl)-1-N,5-N-bis(2-methylphenyl)benzene-1,3,5-tricarboximidate |
| SMILES | COc1ccccc1/N=C(\OC(C)C)c1cc(/C(=N/c2ccccc2C)OC(C)C)cc(/C(=N/c2ccccc2C)OC(C)C)c1 |
| InChI | InChI=1S/C39H45N3O4/c1-25(2)44-37(40-33-18-12-10-16-28(33)7)30-22-31(38(45-26(3)4)41-34-19-13-11-17-29(34)8)24-32(23-30)39(46-27(5)6)42-35-20-14-15-21-36(35)43-9/h10-27H,1-9H3/b40-37-,41-38-,42-39- |
| InChIKey | LCNZFUQGWLFYLA-KXXMNHFISA-N |
| XLogP | 9.82 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|