C14H17N3O — CID 90461233
1-(1,4-dimethylpyrazol-5-yl)-N-(2-methoxyphenyl)ethanimine (PubChem CID 90461233) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-(1,4-dimethylpyrazol-5-yl)-N-(2-methoxyphenyl)ethanimine.
| Compound Name | 1-(1,4-dimethylpyrazol-5-yl)-N-(2-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 90461233 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(1,4-dimethylpyrazol-5-yl)-N-(2-methoxyphenyl)ethanimine |
| SMILES | COc1ccccc1/N=C(\C)c1c(C)cnn1C |
| InChI | InChI=1S/C14H17N3O/c1-10-9-15-17(3)14(10)11(2)16-12-7-5-6-8-13(12)18-4/h5-9H,1-4H3/b16-11+ |
| InChIKey | PNNPSQQIGUBKRU-LFIBNONCSA-N |
| XLogP | 2.88 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|