(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate

C13H14N2O3 — CID 47137693

IUPAC(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate
SMILESCOc1ccccc1OC(=O)c1cnn(C)c1C
InChIInChI=1S/C13H14N2O3/c1-9-10(8-14-15(9)2)13(16)18-12-7-5-4-6-11(12)17-3/h4-8H,1-3H3
InChIKeyDVFPJGMUVAZTSN-UHFFFAOYSA-N
MW246.27 g/mol
LogP1.96
Rot. Bonds3

About (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate

(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate (PubChem CID 47137693) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate.

Molecular Properties

Compound Name(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate
PubChem CID47137693
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Name(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate
SMILESCOc1ccccc1OC(=O)c1cnn(C)c1C
InChIInChI=1S/C13H14N2O3/c1-9-10(8-14-15(9)2)13(16)18-12-7-5-4-6-11(12)17-3/h4-8H,1-3H3
InChIKeyDVFPJGMUVAZTSN-UHFFFAOYSA-N
XLogP1.96
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate?
The IUPAC name of (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate (CID 47137693) is (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate?
The canonical SMILES for (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate is COc1ccccc1OC(=O)c1cnn(C)c1C.
What is the InChIKey of (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate?
The InChIKey is DVFPJGMUVAZTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-9-10(8-14-15(9)2)13(16)18-12-7-5-4-6-11(12)17-3/h4-8H,1-3H3.
What are the key properties of (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate?
(2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate has a molecular weight of 246.27 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl) 1,5-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 47137693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).