C12H10BrN3O4 — CID 71987647
(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate (PubChem CID 71987647) has the molecular formula C12H10BrN3O4 and a molecular weight of 340.13 g/mol. Its IUPAC name is (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate.
| Compound Name | (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71987647 |
| Molecular Formula | C12H10BrN3O4 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(Br)cc2[N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C12H10BrN3O4/c1-7-9(6-14-15(7)2)12(17)20-11-4-3-8(13)5-10(11)16(18)19/h3-6H,1-2H3 |
| InChIKey | NKAVVSRFKWPQKE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|