(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate

C12H10BrN3O4 — CID 71987647

IUPAC(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate
SMILESCc1c(C(=O)Oc2ccc(Br)cc2[N+](=O)[O-])cnn1C
InChIInChI=1S/C12H10BrN3O4/c1-7-9(6-14-15(7)2)12(17)20-11-4-3-8(13)5-10(11)16(18)19/h3-6H,1-2H3
InChIKeyNKAVVSRFKWPQKE-UHFFFAOYSA-N
MW340.13 g/mol
LogP2.62
Rot. Bonds3

About (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate

(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate (PubChem CID 71987647) has the molecular formula C12H10BrN3O4 and a molecular weight of 340.13 g/mol. Its IUPAC name is (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate.

Molecular Properties

Compound Name(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate
PubChem CID71987647
Molecular FormulaC12H10BrN3O4
Molecular Weight340.13 g/mol
Exact Mass338.99
IUPAC Name(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate
SMILESCc1c(C(=O)Oc2ccc(Br)cc2[N+](=O)[O-])cnn1C
InChIInChI=1S/C12H10BrN3O4/c1-7-9(6-14-15(7)2)12(17)20-11-4-3-8(13)5-10(11)16(18)19/h3-6H,1-2H3
InChIKeyNKAVVSRFKWPQKE-UHFFFAOYSA-N
XLogP2.62
TPSA87.26 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.13
LogP ≤ 52.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate?
The IUPAC name of (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate (CID 71987647) is (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate?
The canonical SMILES for (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate is Cc1c(C(=O)Oc2ccc(Br)cc2[N+](=O)[O-])cnn1C.
What is the InChIKey of (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate?
The InChIKey is NKAVVSRFKWPQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3O4/c1-7-9(6-14-15(7)2)12(17)20-11-4-3-8(13)5-10(11)16(18)19/h3-6H,1-2H3.
What are the key properties of (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate?
(4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate has a molecular weight of 340.13 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-nitrophenyl) 1,5-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 71987647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).