C38H30N4Pd — CID 139129664
bis((C,N-diphenylcarbonimidoyl)-phenylazanide);palladium(2+) (PubChem CID 139129664) has the molecular formula C38H30N4Pd and a molecular weight of 649.11 g/mol. Its IUPAC name is bis((C,N-diphenylcarbonimidoyl)-phenylazanide);palladium(2+).
| Compound Name | bis((C,N-diphenylcarbonimidoyl)-phenylazanide);palladium(2+) |
|---|---|
| PubChem CID | 139129664 |
| Molecular Formula | C38H30N4Pd |
| Molecular Weight | 649.11 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | bis((C,N-diphenylcarbonimidoyl)-phenylazanide);palladium(2+) |
| SMILES | [Pd+2].c1ccc(/N=C(/[N-]c2ccccc2)c2ccccc2)cc1.c1ccc(/N=C(/[N-]c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C19H15N2.Pd/c2*1-4-10-16(11-5-1)19(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;/h2*1-15H;/q2*-1;+2 |
| InChIKey | FBSJDYQQYRZQCU-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.11 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|