C20H17ClSe — CID 177449850
1-[(E)-2-chloro-2-cyclopenta-2,4-dien-1-yl-1-phenylselanylethenyl]-4-methylbenzene (PubChem CID 177449850) has the molecular formula C20H17ClSe and a molecular weight of 371.77 g/mol. Its IUPAC name is 1-[(E)-2-chloro-2-cyclopenta-2,4-dien-1-yl-1-phenylselanylethenyl]-4-methylbenzene.
| Compound Name | 1-[(E)-2-chloro-2-cyclopenta-2,4-dien-1-yl-1-phenylselanylethenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 177449850 |
| Molecular Formula | C20H17ClSe |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 1-[(E)-2-chloro-2-cyclopenta-2,4-dien-1-yl-1-phenylselanylethenyl]-4-methylbenzene |
| SMILES | Cc1ccc(/C([Se]c2ccccc2)=C(\Cl)C2C=CC=C2)cc1 |
| InChI | InChI=1S/C20H17ClSe/c1-15-11-13-17(14-12-15)20(19(21)16-7-5-6-8-16)22-18-9-3-2-4-10-18/h2-14,16H,1H3/b20-19+ |
| InChIKey | IGQXIPZCLIIXKB-FMQUCBEESA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|