C18H18OS2Se — CID 122370955
1-(4-methylphenyl)-3,3-bis(methylsulfanyl)-2-phenylselanylprop-2-en-1-one (PubChem CID 122370955) has the molecular formula C18H18OS2Se and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3,3-bis(methylsulfanyl)-2-phenylselanylprop-2-en-1-one.
| Compound Name | 1-(4-methylphenyl)-3,3-bis(methylsulfanyl)-2-phenylselanylprop-2-en-1-one |
|---|---|
| PubChem CID | 122370955 |
| Molecular Formula | C18H18OS2Se |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 1-(4-methylphenyl)-3,3-bis(methylsulfanyl)-2-phenylselanylprop-2-en-1-one |
| SMILES | CSC(SC)=C([Se]c1ccccc1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18OS2Se/c1-13-9-11-14(12-10-13)16(19)17(18(20-2)21-3)22-15-7-5-4-6-8-15/h4-12H,1-3H3 |
| InChIKey | LNLGSANYDWEVLR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|