C16H23O4PS2 — CID 135005313
2-diethoxyphosphoryl-1-(4-methylphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 135005313) has the molecular formula C16H23O4PS2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-(4-methylphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 2-diethoxyphosphoryl-1-(4-methylphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 135005313 |
| Molecular Formula | C16H23O4PS2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-diethoxyphosphoryl-1-(4-methylphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | CCOP(=O)(OCC)C(C(=O)c1ccc(C)cc1)=C(SC)SC |
| InChI | InChI=1S/C16H23O4PS2/c1-6-19-21(18,20-7-2)15(16(22-4)23-5)14(17)13-10-8-12(3)9-11-13/h8-11H,6-7H2,1-5H3 |
| InChIKey | VDTRXJONZPBSNF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|