C12H20O5P2 — CID 59986294
ethoxy-[[ethoxy-(4-methylphenyl)phosphoryl]methyl]phosphinic acid (PubChem CID 59986294) has the molecular formula C12H20O5P2 and a molecular weight of 306.24 g/mol. Its IUPAC name is ethoxy-[[ethoxy-(4-methylphenyl)phosphoryl]methyl]phosphinic acid.
| Compound Name | ethoxy-[[ethoxy-(4-methylphenyl)phosphoryl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 59986294 |
| Molecular Formula | C12H20O5P2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | ethoxy-[[ethoxy-(4-methylphenyl)phosphoryl]methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CP(=O)(OCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H20O5P2/c1-4-16-18(13,10-19(14,15)17-5-2)12-8-6-11(3)7-9-12/h6-9H,4-5,10H2,1-3H3,(H,14,15) |
| InChIKey | WDWZURIMGLMXOQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|