C18H33O9P3 — CID 58708701
[3,5-bis[[ethoxy(hydroxy)phosphoryl]methyl]-2,4,6-trimethylphenyl]methyl-ethoxyphosphinic acid (PubChem CID 58708701) has the molecular formula C18H33O9P3 and a molecular weight of 486.38 g/mol. Its IUPAC name is [3,5-bis[[ethoxy(hydroxy)phosphoryl]methyl]-2,4,6-trimethylphenyl]methyl-ethoxyphosphinic acid.
| Compound Name | [3,5-bis[[ethoxy(hydroxy)phosphoryl]methyl]-2,4,6-trimethylphenyl]methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 58708701 |
| Molecular Formula | C18H33O9P3 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [3,5-bis[[ethoxy(hydroxy)phosphoryl]methyl]-2,4,6-trimethylphenyl]methyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)Cc1c(C)c(CP(=O)(O)OCC)c(C)c(CP(=O)(O)OCC)c1C |
| InChI | InChI=1S/C18H33O9P3/c1-7-25-28(19,20)10-16-13(4)17(11-29(21,22)26-8-2)15(6)18(14(16)5)12-30(23,24)27-9-3/h7-12H2,1-6H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | IMZTYLFEODZZEQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|