About azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate
azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate (PubChem CID 173014442) has the molecular formula C4H18N2O7P2
and a molecular weight of 268.14 g/mol. Its IUPAC name is azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate |
| PubChem CID | 173014442 |
| Molecular Formula | C4H18N2O7P2 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OP(=O)(O)OCC.N.N |
| InChI | InChI=1S/C4H12O7P2.2H3N/c1-3-9-12(5,6)11-13(7,8)10-4-2;;/h3-4H2,1-2H3,(H,5,6)(H,7,8);2*1H3 |
| InChIKey | YKAHYDAKHJQXHY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 172.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate?
The IUPAC name of azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate (CID 173014442) is azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate.
What is the SMILES notation for azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate?
The canonical SMILES for azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate is CCOP(=O)(O)OP(=O)(O)OCC.N.N.
What is the InChIKey of azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate?
The InChIKey is YKAHYDAKHJQXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O7P2.2H3N/c1-3-9-12(5,6)11-13(7,8)10-4-2;;/h3-4H2,1-2H3,(H,5,6)(H,7,8);2*1H3.
What are the key properties of azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate?
azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate has a molecular weight of 268.14 g/mol, XLogP of 1.60, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[ethoxy(hydroxy)phosphoryl] ethyl hydrogen phosphate is sourced from PubChem (CID 173014442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).