C4H14O13P4 — CID 139957080
diethyl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] phosphate (PubChem CID 139957080) has the molecular formula C4H14O13P4 and a molecular weight of 394.04 g/mol. Its IUPAC name is diethyl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] phosphate.
| Compound Name | diethyl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 139957080 |
| Molecular Formula | C4H14O13P4 |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | diethyl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] phosphate |
| SMILES | CCOP(=O)(OCC)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C4H14O13P4/c1-3-13-21(12,14-4-2)17-20(10,11)16-19(8,9)15-18(5,6)7/h3-4H2,1-2H3,(H,8,9)(H,10,11)(H2,5,6,7) |
| InChIKey | FFIBPRHDGXWUKT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|