C3H13O16P5 — CID 159233332
dimethoxyphosphoryl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] methyl phosphate (PubChem CID 159233332) has the molecular formula C3H13O16P5 and a molecular weight of 459.99 g/mol. Its IUPAC name is dimethoxyphosphoryl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] methyl phosphate.
| Compound Name | dimethoxyphosphoryl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] methyl phosphate |
|---|---|
| PubChem CID | 159233332 |
| Molecular Formula | C3H13O16P5 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.89 |
| IUPAC Name | dimethoxyphosphoryl [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] methyl phosphate |
| SMILES | COP(=O)(OC)OP(=O)(OC)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H13O16P5/c1-13-23(11,14-2)19-24(12,15-3)18-22(9,10)17-21(7,8)16-20(4,5)6/h1-3H3,(H,7,8)(H,9,10)(H2,4,5,6) |
| InChIKey | KTEBVPGUQOZFRQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 230.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|