About azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate
azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate (PubChem CID 174777676) has the molecular formula C3H13NO7P2
and a molecular weight of 237.08 g/mol. Its IUPAC name is azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate.
Molecular Properties
| Compound Name | azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate |
| PubChem CID | 174777676 |
| Molecular Formula | C3H13NO7P2 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate |
| SMILES | COP(=O)(O)OP(=O)(OC)OC.N |
| InChI | InChI=1S/C3H10O7P2.H3N/c1-7-11(4,5)10-12(6,8-2)9-3;/h1-3H3,(H,4,5);1H3 |
| InChIKey | JNWJSCRERFZKCO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate?
The IUPAC name of azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate (CID 174777676) is azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate.
What is the SMILES notation for azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate?
The canonical SMILES for azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate is COP(=O)(O)OP(=O)(OC)OC.N.
What is the InChIKey of azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate?
The InChIKey is JNWJSCRERFZKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O7P2.H3N/c1-7-11(4,5)10-12(6,8-2)9-3;/h1-3H3,(H,4,5);1H3.
What are the key properties of azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate?
azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate has a molecular weight of 237.08 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[hydroxy(methoxy)phosphoryl] dimethyl phosphate is sourced from PubChem (CID 174777676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).