C2H10NO9P3 — CID 129308435
[hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxy-N-methylphosphonamidic acid (PubChem CID 129308435) has the molecular formula C2H10NO9P3 and a molecular weight of 285.02 g/mol. Its IUPAC name is [hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxy-N-methylphosphonamidic acid.
| Compound Name | [hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxy-N-methylphosphonamidic acid |
|---|---|
| PubChem CID | 129308435 |
| Molecular Formula | C2H10NO9P3 |
| Molecular Weight | 285.02 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | [hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxy-N-methylphosphonamidic acid |
| SMILES | CNP(=O)(O)OP(=O)(O)OP(=O)(O)OC |
| InChI | InChI=1S/C2H10NO9P3/c1-3-13(4,5)11-15(8,9)12-14(6,7)10-2/h1-2H3,(H,6,7)(H,8,9)(H2,3,4,5) |
| InChIKey | VKOUFAFJZOWUAC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.02 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|