C6H18O13P4 — CID 139957076
[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] dipropan-2-yl phosphate (PubChem CID 139957076) has the molecular formula C6H18O13P4 and a molecular weight of 422.09 g/mol. Its IUPAC name is [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] dipropan-2-yl phosphate.
| Compound Name | [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 139957076 |
| Molecular Formula | C6H18O13P4 |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | [hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl] dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(OC(C)C)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H18O13P4/c1-5(2)15-23(14,16-6(3)4)19-22(12,13)18-21(10,11)17-20(7,8)9/h5-6H,1-4H3,(H,10,11)(H,12,13)(H2,7,8,9) |
| InChIKey | YOJYFBUPWGAHTH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|