C3H11O9P3S — CID 59471498
[hydroxy(phosphonooxy)phosphinothioyl] propan-2-yl hydrogen phosphate (PubChem CID 59471498) has the molecular formula C3H11O9P3S and a molecular weight of 316.10 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphinothioyl] propan-2-yl hydrogen phosphate.
| Compound Name | [hydroxy(phosphonooxy)phosphinothioyl] propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 59471498 |
| Molecular Formula | C3H11O9P3S |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphinothioyl] propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OP(O)(=S)OP(=O)(O)O |
| InChI | InChI=1S/C3H11O9P3S/c1-3(2)10-14(7,8)12-15(9,16)11-13(4,5)6/h3H,1-2H3,(H,7,8)(H,9,16)(H2,4,5,6) |
| InChIKey | CSKLBXPQCMYPEE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|