C3H11O10P3 — CID 59471512
[hydroxy(phosphonooxy)phosphoryl] propan-2-yl hydrogen phosphate (PubChem CID 59471512) has the molecular formula C3H11O10P3 and a molecular weight of 300.03 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl] propan-2-yl hydrogen phosphate.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl] propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 59471512 |
| Molecular Formula | C3H11O10P3 |
| Molecular Weight | 300.03 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl] propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H11O10P3/c1-3(2)11-15(7,8)13-16(9,10)12-14(4,5)6/h3H,1-2H3,(H,7,8)(H,9,10)(H2,4,5,6) |
| InChIKey | FHOOEGIEHZJDMR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.03 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|