C7H19O10P3 — CID 129302859
tert-butyl [hydroxy-[hydroxy(propan-2-yloxy)phosphoryl]oxyphosphoryl] hydrogen phosphate (PubChem CID 129302859) has the molecular formula C7H19O10P3 and a molecular weight of 356.14 g/mol. Its IUPAC name is tert-butyl [hydroxy-[hydroxy(propan-2-yloxy)phosphoryl]oxyphosphoryl] hydrogen phosphate.
| Compound Name | tert-butyl [hydroxy-[hydroxy(propan-2-yloxy)phosphoryl]oxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 129302859 |
| Molecular Formula | C7H19O10P3 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | tert-butyl [hydroxy-[hydroxy(propan-2-yloxy)phosphoryl]oxyphosphoryl] hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC(C)(C)C |
| InChI | InChI=1S/C7H19O10P3/c1-6(2)14-18(8,9)16-20(12,13)17-19(10,11)15-7(3,4)5/h6H,1-5H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | AXIPYPBIDYSMCM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|