C8H19O11P3 — CID 50914907
[hydroxy-[hydroxy-[(E)-4-hydroxy-3-methylbut-2-enoxy]phosphoryl]oxyphosphoryl] propan-2-yl hydrogen phosphate (PubChem CID 50914907) has the molecular formula C8H19O11P3 and a molecular weight of 384.15 g/mol. Its IUPAC name is [hydroxy-[hydroxy-[(E)-4-hydroxy-3-methylbut-2-enoxy]phosphoryl]oxyphosphoryl] propan-2-yl hydrogen phosphate.
| Compound Name | [hydroxy-[hydroxy-[(E)-4-hydroxy-3-methylbut-2-enoxy]phosphoryl]oxyphosphoryl] propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 50914907 |
| Molecular Formula | C8H19O11P3 |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | [hydroxy-[hydroxy-[(E)-4-hydroxy-3-methylbut-2-enoxy]phosphoryl]oxyphosphoryl] propan-2-yl hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)OP(=O)(O)OC(C)C)CO |
| InChI | InChI=1S/C8H19O11P3/c1-7(2)17-21(12,13)19-22(14,15)18-20(10,11)16-5-4-8(3)6-9/h4,7,9H,5-6H2,1-3H3,(H,10,11)(H,12,13)(H,14,15)/b8-4+ |
| InChIKey | OCBFYBTYMVZCQH-XBXARRHUSA-N |
| XLogP | 1.70 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|