C3H10CaO8P2 — CID 175259848
calcium;dihydrogen phosphate;propan-2-yl hydrogen phosphate (PubChem CID 175259848) has the molecular formula C3H10CaO8P2 and a molecular weight of 276.13 g/mol. Its IUPAC name is calcium;dihydrogen phosphate;propan-2-yl hydrogen phosphate.
| Compound Name | calcium;dihydrogen phosphate;propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 175259848 |
| Molecular Formula | C3H10CaO8P2 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | calcium;dihydrogen phosphate;propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)([O-])O.O=P([O-])(O)O.[Ca+2] |
| InChI | InChI=1S/C3H9O4P.Ca.H3O4P/c1-3(2)7-8(4,5)6;;1-5(2,3)4/h3H,1-2H3,(H2,4,5,6);;(H3,1,2,3,4)/q;+2;/p-2 |
| InChIKey | HCHMFSHJMHZJMT-UHFFFAOYSA-L |
| XLogP | -2.07 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|