About fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane
fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane (PubChem CID 87088477) has the molecular formula C5H14F2O4P2
and a molecular weight of 238.11 g/mol. Its IUPAC name is fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane.
Molecular Properties
| Compound Name | fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane |
| PubChem CID | 87088477 |
| Molecular Formula | C5H14F2O4P2 |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane |
| SMILES | CC(C)OP(C)(=O)F.CP(=O)(O)F |
| InChI | InChI=1S/C4H10FO2P.CH4FO2P/c1-4(2)7-8(3,5)6;1-5(2,3)4/h4H,1-3H3;1H3,(H,3,4) |
| InChIKey | KBMMHGMJDKWMTI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane?
The IUPAC name of fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane (CID 87088477) is fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane.
What is the SMILES notation for fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane?
The canonical SMILES for fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane is CC(C)OP(C)(=O)F.CP(=O)(O)F.
What is the InChIKey of fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane?
The InChIKey is KBMMHGMJDKWMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10FO2P.CH4FO2P/c1-4(2)7-8(3,5)6;1-5(2,3)4/h4H,1-3H3;1H3,(H,3,4).
What are the key properties of fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane?
fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane has a molecular weight of 238.11 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(methyl)phosphinic acid;2-[fluoro(methyl)phosphoryl]oxypropane is sourced from PubChem (CID 87088477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).