About copper bis(dipropan-2-yl phosphate)
copper bis(dipropan-2-yl phosphate) (PubChem CID 159825108) has the molecular formula C12H28CuO8P2
and a molecular weight of 425.84 g/mol. Its IUPAC name is copper bis(dipropan-2-yl phosphate).
Molecular Properties
| Compound Name | copper bis(dipropan-2-yl phosphate) |
| PubChem CID | 159825108 |
| Molecular Formula | C12H28CuO8P2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | copper bis(dipropan-2-yl phosphate) |
| SMILES | CC(C)OP(=O)([O-])OC(C)C.CC(C)OP(=O)([O-])OC(C)C.[Cu+2] |
| InChI | InChI=1S/2C6H15O4P.Cu/c2*1-5(2)9-11(7,8)10-6(3)4;/h2*5-6H,1-4H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | NMSUBHYYNADYBR-UHFFFAOYSA-L |
| XLogP | 2.61 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper bis(dipropan-2-yl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(dipropan-2-yl phosphate)?
The IUPAC name of copper bis(dipropan-2-yl phosphate) (CID 159825108) is copper bis(dipropan-2-yl phosphate).
What is the SMILES notation for copper bis(dipropan-2-yl phosphate)?
The canonical SMILES for copper bis(dipropan-2-yl phosphate) is CC(C)OP(=O)([O-])OC(C)C.CC(C)OP(=O)([O-])OC(C)C.[Cu+2].
What is the InChIKey of copper bis(dipropan-2-yl phosphate)?
The InChIKey is NMSUBHYYNADYBR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H15O4P.Cu/c2*1-5(2)9-11(7,8)10-6(3)4;/h2*5-6H,1-4H3,(H,7,8);/q;;+2/p-2.
What are the key properties of copper bis(dipropan-2-yl phosphate)?
copper bis(dipropan-2-yl phosphate) has a molecular weight of 425.84 g/mol, XLogP of 2.61, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(dipropan-2-yl phosphate) is sourced from PubChem (CID 159825108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).