C18H23O2P — CID 23205845
2-[[ethoxy(phenyl)phosphoryl]methyl]-1,3,5-trimethylbenzene (PubChem CID 23205845) has the molecular formula C18H23O2P and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[[ethoxy(phenyl)phosphoryl]methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[[ethoxy(phenyl)phosphoryl]methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 23205845 |
| Molecular Formula | C18H23O2P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[[ethoxy(phenyl)phosphoryl]methyl]-1,3,5-trimethylbenzene |
| SMILES | CCOP(=O)(Cc1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C18H23O2P/c1-5-20-21(19,17-9-7-6-8-10-17)13-18-15(3)11-14(2)12-16(18)4/h6-12H,5,13H2,1-4H3 |
| InChIKey | TYMZWBMKPLVKSI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|