C18H21O3P — CID 171613029
[ethoxy(phenyl)phosphoryl]-(2,4,5-trimethylphenyl)methanone (PubChem CID 171613029) has the molecular formula C18H21O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is [ethoxy(phenyl)phosphoryl]-(2,4,5-trimethylphenyl)methanone.
| Compound Name | [ethoxy(phenyl)phosphoryl]-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 171613029 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [ethoxy(phenyl)phosphoryl]-(2,4,5-trimethylphenyl)methanone |
| SMILES | CCOP(=O)(C(=O)c1cc(C)c(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C18H21O3P/c1-5-21-22(20,16-9-7-6-8-10-16)18(19)17-12-14(3)13(2)11-15(17)4/h6-12H,5H2,1-4H3 |
| InChIKey | VTBYNWNHEGYALQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|