C24H31N2O5P — CID 146277873
N-butyl-N'-[3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]oxamide (PubChem CID 146277873) has the molecular formula C24H31N2O5P and a molecular weight of 458.50 g/mol. Its IUPAC name is N-butyl-N'-[3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]oxamide.
| Compound Name | N-butyl-N'-[3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]oxamide |
|---|---|
| PubChem CID | 146277873 |
| Molecular Formula | C24H31N2O5P |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-butyl-N'-[3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]oxamide |
| SMILES | CCCCNC(=O)C(=O)Nc1c(C)cc(C)c(C(=O)P(=O)(OCC)c2ccccc2)c1C |
| InChI | InChI=1S/C24H31N2O5P/c1-6-8-14-25-22(27)23(28)26-21-17(4)15-16(3)20(18(21)5)24(29)32(30,31-7-2)19-12-10-9-11-13-19/h9-13,15H,6-8,14H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | PPSSZGINBKWTOI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|